About methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate
methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 130758105) has the molecular formula C8H11Br2NO2
and a molecular weight of 312.99 g/mol. Its IUPAC name is methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate.
Molecular Properties
| Compound Name | methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| PubChem CID | 130758105 |
| Molecular Formula | C8H11Br2NO2 |
| Molecular Weight | 312.99 g/mol |
| Exact Mass | 310.92 |
| IUPAC Name | methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | COC(=O)N1CC[C@H]2[C@@H](C1)C2(Br)Br |
| InChI | InChI=1S/C8H11Br2NO2/c1-13-7(12)11-3-2-5-6(4-11)8(5,9)10/h5-6H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | GGMZJKYPZWLZHE-NTSWFWBYSA-N |
| XLogP | 2.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.99 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate?
The IUPAC name of methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate (CID 130758105) is methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate.
What is the SMILES notation for methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate?
The canonical SMILES for methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate is COC(=O)N1CC[C@H]2[C@@H](C1)C2(Br)Br.
What is the InChIKey of methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate?
The InChIKey is GGMZJKYPZWLZHE-NTSWFWBYSA-N. The full InChI is InChI=1S/C8H11Br2NO2/c1-13-7(12)11-3-2-5-6(4-11)8(5,9)10/h5-6H,2-4H2,1H3/t5-,6+/m0/s1.
What are the key properties of methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate?
methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate has a molecular weight of 312.99 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane-3-carboxylate is sourced from PubChem (CID 130758105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).