C9H16F2N2O — CID 130758492
1-[(3,3-difluorocyclobutyl)methyl]-3-propan-2-ylurea (PubChem CID 130758492) has the molecular formula C9H16F2N2O and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclobutyl)methyl]-3-propan-2-ylurea.
| Compound Name | 1-[(3,3-difluorocyclobutyl)methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 130758492 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1-[(3,3-difluorocyclobutyl)methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCC1CC(F)(F)C1 |
| InChI | InChI=1S/C9H16F2N2O/c1-6(2)13-8(14)12-5-7-3-9(10,11)4-7/h6-7H,3-5H2,1-2H3,(H2,12,13,14) |
| InChIKey | OYPVJVFJLARRDO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |