About N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide
N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide (PubChem CID 130762934) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide |
| PubChem CID | 130762934 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide |
| SMILES | Cc1nonc1CNC(=O)C1CNC1 |
| InChI | InChI=1S/C8H12N4O2/c1-5-7(12-14-11-5)4-10-8(13)6-2-9-3-6/h6,9H,2-4H2,1H3,(H,10,13) |
| InChIKey | XVDMHRZLIZUAAC-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide?
The IUPAC name of N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide (CID 130762934) is N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide.
What is the SMILES notation for N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide?
The canonical SMILES for N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide is Cc1nonc1CNC(=O)C1CNC1.
What is the InChIKey of N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide?
The InChIKey is XVDMHRZLIZUAAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c1-5-7(12-14-11-5)4-10-8(13)6-2-9-3-6/h6,9H,2-4H2,1H3,(H,10,13).
What are the key properties of N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide?
N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide has a molecular weight of 196.21 g/mol, XLogP of -0.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]azetidine-3-carboxamide is sourced from PubChem (CID 130762934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).