C11H19ClO2 — CID 130763736
(5S,6R)-5-chloro-4,4-dimethyl-6-(2-methylpropyl)oxan-2-one (PubChem CID 130763736) has the molecular formula C11H19ClO2 and a molecular weight of 218.72 g/mol. Its IUPAC name is (5S,6R)-5-chloro-4,4-dimethyl-6-(2-methylpropyl)oxan-2-one.
| Compound Name | (5S,6R)-5-chloro-4,4-dimethyl-6-(2-methylpropyl)oxan-2-one |
|---|---|
| PubChem CID | 130763736 |
| Molecular Formula | C11H19ClO2 |
| Molecular Weight | 218.72 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (5S,6R)-5-chloro-4,4-dimethyl-6-(2-methylpropyl)oxan-2-one |
| SMILES | CC(C)C[C@H]1OC(=O)CC(C)(C)[C@@H]1Cl |
| InChI | InChI=1S/C11H19ClO2/c1-7(2)5-8-10(12)11(3,4)6-9(13)14-8/h7-8,10H,5-6H2,1-4H3/t8-,10-/m1/s1 |
| InChIKey | WJALOWNIBPLXTJ-PSASIEDQSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|