C11H20O3 — CID 131845339
(4S,5S)-4,5-bis(2-methylpropyl)-1,3-dioxolan-2-one (PubChem CID 131845339) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (4S,5S)-4,5-bis(2-methylpropyl)-1,3-dioxolan-2-one.
| Compound Name | (4S,5S)-4,5-bis(2-methylpropyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 131845339 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (4S,5S)-4,5-bis(2-methylpropyl)-1,3-dioxolan-2-one |
| SMILES | CC(C)C[C@@H]1OC(=O)O[C@H]1CC(C)C |
| InChI | InChI=1S/C11H20O3/c1-7(2)5-9-10(6-8(3)4)14-11(12)13-9/h7-10H,5-6H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | OKJTXWXBYZXLHY-UWVGGRQHSA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |