C9H16O5S2 — CID 141401518
4,5-bis(ethylsulfinylmethyl)-1,3-dioxolan-2-one (PubChem CID 141401518) has the molecular formula C9H16O5S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolan-2-one.
| Compound Name | 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 141401518 |
| Molecular Formula | C9H16O5S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolan-2-one |
| SMILES | CCS(=O)CC1OC(=O)OC1CS(=O)CC |
| InChI | InChI=1S/C9H16O5S2/c1-3-15(11)5-7-8(6-16(12)4-2)14-9(10)13-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | XPHFLIPVHXEONI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |