C12H21NO — CID 130765107
(3R,4R)-3-(cyclohepten-1-yl)piperidin-4-ol (PubChem CID 130765107) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3R,4R)-3-(cyclohepten-1-yl)piperidin-4-ol.
| Compound Name | (3R,4R)-3-(cyclohepten-1-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 130765107 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3R,4R)-3-(cyclohepten-1-yl)piperidin-4-ol |
| SMILES | O[C@@H]1CCNC[C@H]1C1=CCCCCC1 |
| InChI | InChI=1S/C12H21NO/c14-12-7-8-13-9-11(12)10-5-3-1-2-4-6-10/h5,11-14H,1-4,6-9H2/t11-,12+/m0/s1 |
| InChIKey | CQJATDHBUADOBA-NWDGAFQWSA-N |
| XLogP | 1.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|