C9H15NO — CID 141412740
1,2,3,4,4a,5,6,7-octahydroquinolin-4-ol (PubChem CID 141412740) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7-octahydroquinolin-4-ol.
| Compound Name | 1,2,3,4,4a,5,6,7-octahydroquinolin-4-ol |
|---|---|
| PubChem CID | 141412740 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1,2,3,4,4a,5,6,7-octahydroquinolin-4-ol |
| SMILES | OC1CCNC2=CCCCC21 |
| InChI | InChI=1S/C9H15NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h4,7,9-11H,1-3,5-6H2 |
| InChIKey | XHKQKRQJQPIYLW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |