C9H6F5NO — CID 130770723
N-[4-(difluoromethyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 130770723) has the molecular formula C9H6F5NO and a molecular weight of 239.14 g/mol. Its IUPAC name is N-[4-(difluoromethyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-(difluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 130770723 |
| Molecular Formula | C9H6F5NO |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | N-[4-(difluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(C(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H6F5NO/c10-7(11)5-1-3-6(4-2-5)15-8(16)9(12,13)14/h1-4,7H,(H,15,16) |
| InChIKey | BPWZNTVWGARUFV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |