C10H15Cl2N3O — CID 130774871
(2R)-N-methyl-N-pyridin-3-ylazetidine-2-carboxamide;dihydrochloride (PubChem CID 130774871) has the molecular formula C10H15Cl2N3O and a molecular weight of 264.16 g/mol. Its IUPAC name is (2R)-N-methyl-N-pyridin-3-ylazetidine-2-carboxamide;dihydrochloride.
| Compound Name | (2R)-N-methyl-N-pyridin-3-ylazetidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 130774871 |
| Molecular Formula | C10H15Cl2N3O |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (2R)-N-methyl-N-pyridin-3-ylazetidine-2-carboxamide;dihydrochloride |
| SMILES | CN(C(=O)[C@H]1CCN1)c1cccnc1.Cl.Cl |
| InChI | InChI=1S/C10H13N3O.2ClH/c1-13(8-3-2-5-11-7-8)10(14)9-4-6-12-9;;/h2-3,5,7,9,12H,4,6H2,1H3;2*1H/t9-;;/m1../s1 |
| InChIKey | CSYWPKHRYVRDCL-KLQYNRQASA-N |
| XLogP | 1.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |