C15H20N2O3 — CID 114511846
4-ethyl-2-[methyl(pyridin-3-yl)carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 114511846) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-ethyl-2-[methyl(pyridin-3-yl)carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 4-ethyl-2-[methyl(pyridin-3-yl)carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114511846 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-ethyl-2-[methyl(pyridin-3-yl)carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CCC1CC(C(=O)O)C(C(=O)N(C)c2cccnc2)C1 |
| InChI | InChI=1S/C15H20N2O3/c1-3-10-7-12(13(8-10)15(19)20)14(18)17(2)11-5-4-6-16-9-11/h4-6,9-10,12-13H,3,7-8H2,1-2H3,(H,19,20) |
| InChIKey | WNMJCHHEIXXZIV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |