2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid

C7H5ClFNO2 — CID 130775275

IUPAC2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid
SMILESO=C(O)Cc1cc(F)c(Cl)cn1
InChIInChI=1S/C7H5ClFNO2/c8-5-3-10-4(1-6(5)9)2-7(11)12/h1,3H,2H2,(H,11,12)
InChIKeyHBCNKKAUKQZOCL-UHFFFAOYSA-N
MW189.57 g/mol
LogP1.50
Rot. Bonds2

About 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid

2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid (PubChem CID 130775275) has the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. Its IUPAC name is 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid.

Molecular Properties

Compound Name2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid
PubChem CID130775275
Molecular FormulaC7H5ClFNO2
Molecular Weight189.57 g/mol
Exact Mass189.00
IUPAC Name2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid
SMILESO=C(O)Cc1cc(F)c(Cl)cn1
InChIInChI=1S/C7H5ClFNO2/c8-5-3-10-4(1-6(5)9)2-7(11)12/h1,3H,2H2,(H,11,12)
InChIKeyHBCNKKAUKQZOCL-UHFFFAOYSA-N
XLogP1.50
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.57
LogP ≤ 51.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[5-chloro-4-(difluoromethyl)-2-pyridinyl]acetic acid
CID 130095685
2-(4-fluoro-5-phenyl-2-pyridinyl)acetic acid
CID 133095784
2-(6-chloro-4-fluoro-3-pyridinyl)acetic acid
CID 119016121
2-(5-chloro-4-fluoro-2-pyridinyl)acetonitrile
CID 130980972
2-[4-(difluoromethoxy)-5-fluoro-2-pyridinyl]acetic acid
CID 137346925
2-(2-bromo-5-chloro-4-fluorophenyl)acetic acid
CID 68614790
2-(2-amino-4-chloro-5-fluorophenyl)acetic acid
CID 19763734
2-[5-chloro-2-(difluoromethyl)-4-pyridinyl]acetic acid
CID 130095692
2-(4-bromo-5-methyl-2-pyridinyl)acetic acid
CID 118799239
2-[5-fluoro-2-(2,3,5-trichlorophenyl)-4-pyridinyl]acetic acid
CID 134637610
2-[6-(4-chlorophenyl)pyrimidin-4-yl]acetic acid
CID 117000602
2-(4-chloro-2-fluorophenyl)acetic acid
CID 2757563

Frequently Asked Questions

What is the IUPAC name of 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid?
The IUPAC name of 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid (CID 130775275) is 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid.
What is the SMILES notation for 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid?
The canonical SMILES for 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid is O=C(O)Cc1cc(F)c(Cl)cn1.
What is the InChIKey of 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid?
The InChIKey is HBCNKKAUKQZOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClFNO2/c8-5-3-10-4(1-6(5)9)2-7(11)12/h1,3H,2H2,(H,11,12).
What are the key properties of 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid?
2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid has a molecular weight of 189.57 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-4-fluoro-2-pyridinyl)acetic acid is sourced from PubChem (CID 130775275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).