C8H8BrNO2 — CID 118799239
2-(4-bromo-5-methyl-2-pyridinyl)acetic acid (PubChem CID 118799239) has the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. Its IUPAC name is 2-(4-bromo-5-methyl-2-pyridinyl)acetic acid.
| Compound Name | 2-(4-bromo-5-methyl-2-pyridinyl)acetic acid |
|---|---|
| PubChem CID | 118799239 |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 2-(4-bromo-5-methyl-2-pyridinyl)acetic acid |
| SMILES | Cc1cnc(CC(=O)O)cc1Br |
| InChI | InChI=1S/C8H8BrNO2/c1-5-4-10-6(2-7(5)9)3-8(11)12/h2,4H,3H2,1H3,(H,11,12) |
| InChIKey | OMQFEJPLXMEBIF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |