C27H24O6 — CID 134370983
2-[7,10-bis(carboxymethyl)-3,6,11-trimethyltriphenylen-2-yl]acetic acid (PubChem CID 134370983) has the molecular formula C27H24O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-[7,10-bis(carboxymethyl)-3,6,11-trimethyltriphenylen-2-yl]acetic acid.
| Compound Name | 2-[7,10-bis(carboxymethyl)-3,6,11-trimethyltriphenylen-2-yl]acetic acid |
|---|---|
| PubChem CID | 134370983 |
| Molecular Formula | C27H24O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[7,10-bis(carboxymethyl)-3,6,11-trimethyltriphenylen-2-yl]acetic acid |
| SMILES | Cc1cc2c3cc(C)c(CC(=O)O)cc3c3cc(CC(=O)O)c(C)cc3c2cc1CC(=O)O |
| InChI | InChI=1S/C27H24O6/c1-13-4-19-20-5-14(2)17(11-26(30)31)8-23(20)24-9-18(12-27(32)33)15(3)6-21(24)22(19)7-16(13)10-25(28)29/h4-9H,10-12H2,1-3H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | WZHUBDVHHAOVDK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|