2-(5-hydroxy-2,3-dimethylphenyl)acetic acid

C10H12O3 — CID 118996271

IUPAC2-(5-hydroxy-2,3-dimethylphenyl)acetic acid
SMILESCc1cc(O)cc(CC(=O)O)c1C
InChIInChI=1S/C10H12O3/c1-6-3-9(11)4-8(7(6)2)5-10(12)13/h3-4,11H,5H2,1-2H3,(H,12,13)
InChIKeyDJQYYFVXXDBWDG-UHFFFAOYSA-N
MW180.20 g/mol
LogP1.64
Rot. Bonds2

About 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid

2-(5-hydroxy-2,3-dimethylphenyl)acetic acid (PubChem CID 118996271) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-(5-hydroxy-2,3-dimethylphenyl)acetic acid
PubChem CID118996271
Molecular FormulaC10H12O3
Molecular Weight180.20 g/mol
Exact Mass180.08
IUPAC Name2-(5-hydroxy-2,3-dimethylphenyl)acetic acid
SMILESCc1cc(O)cc(CC(=O)O)c1C
InChIInChI=1S/C10H12O3/c1-6-3-9(11)4-8(7(6)2)5-10(12)13/h3-4,11H,5H2,1-2H3,(H,12,13)
InChIKeyDJQYYFVXXDBWDG-UHFFFAOYSA-N
XLogP1.64
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.20
LogP ≤ 51.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid?
The IUPAC name of 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid (CID 118996271) is 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid.
What is the SMILES notation for 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid?
The canonical SMILES for 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid is Cc1cc(O)cc(CC(=O)O)c1C.
What is the InChIKey of 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid?
The InChIKey is DJQYYFVXXDBWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6-3-9(11)4-8(7(6)2)5-10(12)13/h3-4,11H,5H2,1-2H3,(H,12,13).
What are the key properties of 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid?
2-(5-hydroxy-2,3-dimethylphenyl)acetic acid has a molecular weight of 180.20 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-hydroxy-2,3-dimethylphenyl)acetic acid is sourced from PubChem (CID 118996271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).