C8H14N4O — CID 130778456
(1-methyl-3-propylpyrazol-5-yl)urea (PubChem CID 130778456) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is (1-methyl-3-propylpyrazol-5-yl)urea.
| Compound Name | (1-methyl-3-propylpyrazol-5-yl)urea |
|---|---|
| PubChem CID | 130778456 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (1-methyl-3-propylpyrazol-5-yl)urea |
| SMILES | CCCc1cc(NC(N)=O)n(C)n1 |
| InChI | InChI=1S/C8H14N4O/c1-3-4-6-5-7(10-8(9)13)12(2)11-6/h5H,3-4H2,1-2H3,(H3,9,10,13) |
| InChIKey | LZGZLSYTGJHJMG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |