C15H24N6O — CID 99587018
1-(1-methyl-3-propylpyrazol-5-yl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea (PubChem CID 99587018) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(1-methyl-3-propylpyrazol-5-yl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea.
| Compound Name | 1-(1-methyl-3-propylpyrazol-5-yl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 99587018 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-(1-methyl-3-propylpyrazol-5-yl)-3-[(2S)-1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]urea |
| SMILES | CCCc1cc(NC(=O)N[C@@H](C)Cc2cc(C)[nH]n2)n(C)n1 |
| InChI | InChI=1S/C15H24N6O/c1-5-6-12-9-14(21(4)20-12)17-15(22)16-10(2)7-13-8-11(3)18-19-13/h8-10H,5-7H2,1-4H3,(H,18,19)(H2,16,17,22)/t10-/m0/s1 |
| InChIKey | VHTSYGRBEZZMBE-JTQLQIEISA-N |
| XLogP | 2.16 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |