C12H16N2O — CID 130785485
(2-amino-3-pyridinyl)-(2-methylcyclopentyl)methanone (PubChem CID 130785485) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (2-amino-3-pyridinyl)-(2-methylcyclopentyl)methanone.
| Compound Name | (2-amino-3-pyridinyl)-(2-methylcyclopentyl)methanone |
|---|---|
| PubChem CID | 130785485 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (2-amino-3-pyridinyl)-(2-methylcyclopentyl)methanone |
| SMILES | CC1CCCC1C(=O)c1cccnc1N |
| InChI | InChI=1S/C12H16N2O/c1-8-4-2-5-9(8)11(15)10-6-3-7-14-12(10)13/h3,6-9H,2,4-5H2,1H3,(H2,13,14) |
| InChIKey | XMBYRDIEWAHJJA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |