C17H19N — CID 156752510
8-[1-[(2S)-2-methylcyclopentyl]ethenyl]quinoline (PubChem CID 156752510) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 8-[1-[(2S)-2-methylcyclopentyl]ethenyl]quinoline.
| Compound Name | 8-[1-[(2S)-2-methylcyclopentyl]ethenyl]quinoline |
|---|---|
| PubChem CID | 156752510 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 8-[1-[(2S)-2-methylcyclopentyl]ethenyl]quinoline |
| SMILES | C=C(c1cccc2cccnc12)C1CCC[C@@H]1C |
| InChI | InChI=1S/C17H19N/c1-12-6-3-9-15(12)13(2)16-10-4-7-14-8-5-11-18-17(14)16/h4-5,7-8,10-12,15H,2-3,6,9H2,1H3/t12-,15?/m0/s1 |
| InChIKey | FQENMWVBIGPBMP-SFVWDYPZSA-N |
| XLogP | 4.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |