C9H5ClF2S — CID 130786097
7-(chloromethyl)-4,5-difluoro-1-benzothiophene (PubChem CID 130786097) has the molecular formula C9H5ClF2S and a molecular weight of 218.66 g/mol. Its IUPAC name is 7-(chloromethyl)-4,5-difluoro-1-benzothiophene.
| Compound Name | 7-(chloromethyl)-4,5-difluoro-1-benzothiophene |
|---|---|
| PubChem CID | 130786097 |
| Molecular Formula | C9H5ClF2S |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 7-(chloromethyl)-4,5-difluoro-1-benzothiophene |
| SMILES | Fc1cc(CCl)c2sccc2c1F |
| InChI | InChI=1S/C9H5ClF2S/c10-4-5-3-7(11)8(12)6-1-2-13-9(5)6/h1-3H,4H2 |
| InChIKey | AJNNCSOEXUXENQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|