C9H7ClO2S — CID 131191604
7-(chloromethyl)-1-benzothiophene-4,5-diol (PubChem CID 131191604) has the molecular formula C9H7ClO2S and a molecular weight of 214.67 g/mol. Its IUPAC name is 7-(chloromethyl)-1-benzothiophene-4,5-diol.
| Compound Name | 7-(chloromethyl)-1-benzothiophene-4,5-diol |
|---|---|
| PubChem CID | 131191604 |
| Molecular Formula | C9H7ClO2S |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 7-(chloromethyl)-1-benzothiophene-4,5-diol |
| SMILES | Oc1cc(CCl)c2sccc2c1O |
| InChI | InChI=1S/C9H7ClO2S/c10-4-5-3-7(11)8(12)6-1-2-13-9(5)6/h1-3,11-12H,4H2 |
| InChIKey | QWERFFKDFCPLLS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|