C8H12N2O2 — CID 130794068
4-methyl-3-pyrrolidin-2-yl-2H-1,2-oxazol-5-one (PubChem CID 130794068) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-methyl-3-pyrrolidin-2-yl-2H-1,2-oxazol-5-one.
| Compound Name | 4-methyl-3-pyrrolidin-2-yl-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 130794068 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 4-methyl-3-pyrrolidin-2-yl-2H-1,2-oxazol-5-one |
| SMILES | Cc1c(C2CCCN2)[nH]oc1=O |
| InChI | InChI=1S/C8H12N2O2/c1-5-7(10-12-8(5)11)6-3-2-4-9-6/h6,9-10H,2-4H2,1H3 |
| InChIKey | XXOLYTFORBUBNR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |