C8H13NO — CID 130802511
1-(2-methyl-1,2-dihydropyridin-5-yl)ethanol (PubChem CID 130802511) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-(2-methyl-1,2-dihydropyridin-5-yl)ethanol.
| Compound Name | 1-(2-methyl-1,2-dihydropyridin-5-yl)ethanol |
|---|---|
| PubChem CID | 130802511 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1-(2-methyl-1,2-dihydropyridin-5-yl)ethanol |
| SMILES | CC1C=CC(C(C)O)=CN1 |
| InChI | InChI=1S/C8H13NO/c1-6-3-4-8(5-9-6)7(2)10/h3-7,9-10H,1-2H3 |
| InChIKey | CHOWXYSIWVBRHJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |