About 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol
5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol (PubChem CID 70473481) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol |
| PubChem CID | 70473481 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol |
| SMILES | CC(C)=CC1=C(O)C(C)NC=C1CO |
| InChI | InChI=1S/C11H17NO2/c1-7(2)4-10-9(6-13)5-12-8(3)11(10)14/h4-5,8,12-14H,6H2,1-3H3 |
| InChIKey | UBWAMTJEAAROFT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol?
The IUPAC name of 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol (CID 70473481) is 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol.
What is the SMILES notation for 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol?
The canonical SMILES for 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol is CC(C)=CC1=C(O)C(C)NC=C1CO.
What is the InChIKey of 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol?
The InChIKey is UBWAMTJEAAROFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-7(2)4-10-9(6-13)5-12-8(3)11(10)14/h4-5,8,12-14H,6H2,1-3H3.
What are the key properties of 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol?
5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol has a molecular weight of 195.26 g/mol, XLogP of 1.63, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-2-methyl-4-(2-methylprop-1-enyl)-1,2-dihydropyridin-3-ol is sourced from PubChem (CID 70473481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).