C11H23NO2 — CID 130802812
(3S,5R)-1-(3-hydroxy-3-methylbutyl)-5-methylpiperidin-3-ol (PubChem CID 130802812) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is (3S,5R)-1-(3-hydroxy-3-methylbutyl)-5-methylpiperidin-3-ol.
| Compound Name | (3S,5R)-1-(3-hydroxy-3-methylbutyl)-5-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 130802812 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | (3S,5R)-1-(3-hydroxy-3-methylbutyl)-5-methylpiperidin-3-ol |
| SMILES | C[C@@H]1C[C@H](O)CN(CCC(C)(C)O)C1 |
| InChI | InChI=1S/C11H23NO2/c1-9-6-10(13)8-12(7-9)5-4-11(2,3)14/h9-10,13-14H,4-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | DVCFCDRZNIPDPB-ZJUUUORDSA-N |
| XLogP | 0.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |