C8H7Cl2N3 — CID 130804087
(2,3-dichloro-1H-pyrrolo[2,3-b]pyridin-6-yl)methanamine (PubChem CID 130804087) has the molecular formula C8H7Cl2N3 and a molecular weight of 216.07 g/mol. Its IUPAC name is (2,3-dichloro-1H-pyrrolo[2,3-b]pyridin-6-yl)methanamine.
| Compound Name | (2,3-dichloro-1H-pyrrolo[2,3-b]pyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 130804087 |
| Molecular Formula | C8H7Cl2N3 |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | (2,3-dichloro-1H-pyrrolo[2,3-b]pyridin-6-yl)methanamine |
| SMILES | NCc1ccc2c(Cl)c(Cl)[nH]c2n1 |
| InChI | InChI=1S/C8H7Cl2N3/c9-6-5-2-1-4(3-11)12-8(5)13-7(6)10/h1-2H,3,11H2,(H,12,13) |
| InChIKey | UUECUUVDBUCDPI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |