C6H10N4 — CID 82502425
6-(aminomethyl)pyridine-2,3-diamine (PubChem CID 82502425) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 6-(aminomethyl)pyridine-2,3-diamine.
| Compound Name | 6-(aminomethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 82502425 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 6-(aminomethyl)pyridine-2,3-diamine |
| SMILES | NCc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C6H10N4/c7-3-4-1-2-5(8)6(9)10-4/h1-2H,3,7-8H2,(H2,9,10) |
| InChIKey | HGODUSFIVVVFAA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |