About 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one
1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one (PubChem CID 130806519) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one.
Analyze 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one?
The IUPAC name of 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one (CID 130806519) is 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one.
What is the SMILES notation for 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one?
The canonical SMILES for 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one is CC(C(=O)C1=COCC1)C(C)(C)C.
What is the InChIKey of 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one?
The InChIKey is QZYCAZBIZFPHKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-8(11(2,3)4)10(12)9-5-6-13-7-9/h7-8H,5-6H2,1-4H3.
What are the key properties of 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one?
1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one has a molecular weight of 182.26 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydrofuran-4-yl)-2,3,3-trimethylbutan-1-one is sourced from PubChem (CID 130806519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).