4-ethoxyoxolane-3-sulfonyl fluoride

C6H11FO4S — CID 130815232

IUPAC4-ethoxyoxolane-3-sulfonyl fluoride
SMILESCCOC1COCC1S(=O)(=O)F
InChIInChI=1S/C6H11FO4S/c1-2-11-5-3-10-4-6(5)12(7,8)9/h5-6H,2-4H2,1H3
InChIKeyJKWGWJNKTLWIJO-UHFFFAOYSA-N
MW198.21 g/mol
LogP0.09
Rot. Bonds3

About 4-ethoxyoxolane-3-sulfonyl fluoride

4-ethoxyoxolane-3-sulfonyl fluoride (PubChem CID 130815232) has the molecular formula C6H11FO4S and a molecular weight of 198.21 g/mol. Its IUPAC name is 4-ethoxyoxolane-3-sulfonyl fluoride.

Molecular Properties

Compound Name4-ethoxyoxolane-3-sulfonyl fluoride
PubChem CID130815232
Molecular FormulaC6H11FO4S
Molecular Weight198.21 g/mol
Exact Mass198.04
IUPAC Name4-ethoxyoxolane-3-sulfonyl fluoride
SMILESCCOC1COCC1S(=O)(=O)F
InChIInChI=1S/C6H11FO4S/c1-2-11-5-3-10-4-6(5)12(7,8)9/h5-6H,2-4H2,1H3
InChIKeyJKWGWJNKTLWIJO-UHFFFAOYSA-N
XLogP0.09
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.21
LogP ≤ 50.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 4-ethoxyoxolane-3-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Oxolan-3-yl methanesulfonate
CID 15278452
rac-(3R,4S)-4-methoxyoxolane-3-sulfonyl chloride
CID 124710168
1-(2-Ethoxypropoxy)ethanesulfonyl fluoride
CID 88593195
2-(2,2-Dimethyl-1,3-dioxolan-4-yl)ethane-1-sulfonyl fluoride
CID 140109500
Fluoro 2-(1-ethoxypropan-2-yloxy)ethanesulfonate
CID 140477262
1-(2-Propoxypropoxy)ethanesulfonyl fluoride
CID 154094011
2-(Oxiran-2-ylmethoxy)ethanesulfonyl fluoride
CID 163658272
(3R,4S)-4-Methoxyoxolane-3-sulfonyl fluoride
CID 130915436
4-Methoxyoxolane-3-sulfonyl fluoride
CID 130973853
2,3-Dimethoxypropane-1-sulfonyl fluoride
CID 164663687
(3-Ethoxyoxolan-3-yl)methanesulfonyl fluoride
CID 165459874
2-Methyloxolane-3-sulfonyl fluoride
CID 165460627

Frequently Asked Questions

What is the IUPAC name of 4-ethoxyoxolane-3-sulfonyl fluoride?
The IUPAC name of 4-ethoxyoxolane-3-sulfonyl fluoride (CID 130815232) is 4-ethoxyoxolane-3-sulfonyl fluoride.
What is the SMILES notation for 4-ethoxyoxolane-3-sulfonyl fluoride?
The canonical SMILES for 4-ethoxyoxolane-3-sulfonyl fluoride is CCOC1COCC1S(=O)(=O)F.
What is the InChIKey of 4-ethoxyoxolane-3-sulfonyl fluoride?
The InChIKey is JKWGWJNKTLWIJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO4S/c1-2-11-5-3-10-4-6(5)12(7,8)9/h5-6H,2-4H2,1H3.
What are the key properties of 4-ethoxyoxolane-3-sulfonyl fluoride?
4-ethoxyoxolane-3-sulfonyl fluoride has a molecular weight of 198.21 g/mol, XLogP of 0.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxyoxolane-3-sulfonyl fluoride is sourced from PubChem (CID 130815232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).