4-methoxyoxolane-3-sulfonyl fluoride

C5H9FO4S — CID 130973853

IUPAC4-methoxyoxolane-3-sulfonyl fluoride
SMILESCOC1COCC1S(=O)(=O)F
InChIInChI=1S/C5H9FO4S/c1-9-4-2-10-3-5(4)11(6,7)8/h4-5H,2-3H2,1H3
InChIKeyGOUJURCUIDJLCN-UHFFFAOYSA-N
MW184.19 g/mol
LogP-0.30
Rot. Bonds2

About 4-methoxyoxolane-3-sulfonyl fluoride

4-methoxyoxolane-3-sulfonyl fluoride (PubChem CID 130973853) has the molecular formula C5H9FO4S and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-methoxyoxolane-3-sulfonyl fluoride.

Molecular Properties

Compound Name4-methoxyoxolane-3-sulfonyl fluoride
PubChem CID130973853
Molecular FormulaC5H9FO4S
Molecular Weight184.19 g/mol
Exact Mass184.02
IUPAC Name4-methoxyoxolane-3-sulfonyl fluoride
SMILESCOC1COCC1S(=O)(=O)F
InChIInChI=1S/C5H9FO4S/c1-9-4-2-10-3-5(4)11(6,7)8/h4-5H,2-3H2,1H3
InChIKeyGOUJURCUIDJLCN-UHFFFAOYSA-N
XLogP-0.30
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 5-0.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 4-methoxyoxolane-3-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxyoxolane-3-sulfonyl fluoride?
The IUPAC name of 4-methoxyoxolane-3-sulfonyl fluoride (CID 130973853) is 4-methoxyoxolane-3-sulfonyl fluoride.
What is the SMILES notation for 4-methoxyoxolane-3-sulfonyl fluoride?
The canonical SMILES for 4-methoxyoxolane-3-sulfonyl fluoride is COC1COCC1S(=O)(=O)F.
What is the InChIKey of 4-methoxyoxolane-3-sulfonyl fluoride?
The InChIKey is GOUJURCUIDJLCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FO4S/c1-9-4-2-10-3-5(4)11(6,7)8/h4-5H,2-3H2,1H3.
What are the key properties of 4-methoxyoxolane-3-sulfonyl fluoride?
4-methoxyoxolane-3-sulfonyl fluoride has a molecular weight of 184.19 g/mol, XLogP of -0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyoxolane-3-sulfonyl fluoride is sourced from PubChem (CID 130973853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).