C8H12ClN3S — CID 130815414
3-[(3-chloropiperidin-1-yl)methyl]-1,2,5-thiadiazole (PubChem CID 130815414) has the molecular formula C8H12ClN3S and a molecular weight of 217.72 g/mol. Its IUPAC name is 3-[(3-chloropiperidin-1-yl)methyl]-1,2,5-thiadiazole.
| Compound Name | 3-[(3-chloropiperidin-1-yl)methyl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 130815414 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 3-[(3-chloropiperidin-1-yl)methyl]-1,2,5-thiadiazole |
| SMILES | ClC1CCCN(Cc2cnsn2)C1 |
| InChI | InChI=1S/C8H12ClN3S/c9-7-2-1-3-12(5-7)6-8-4-10-13-11-8/h4,7H,1-3,5-6H2 |
| InChIKey | PKSUWPGARLXNTA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|