C11H17NO2 — CID 130820095
2-(3-methylcyclobutyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid (PubChem CID 130820095) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(3-methylcyclobutyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid.
| Compound Name | 2-(3-methylcyclobutyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid |
|---|---|
| PubChem CID | 130820095 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(3-methylcyclobutyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid |
| SMILES | CC1CC(N2CC3CC2C3C(=O)O)C1 |
| InChI | InChI=1S/C11H17NO2/c1-6-2-8(3-6)12-5-7-4-9(12)10(7)11(13)14/h6-10H,2-5H2,1H3,(H,13,14) |
| InChIKey | XWYZEEMIIZPUGP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |