C8H12N2O3 — CID 130840927
2-(methylcarbamoyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid (PubChem CID 130840927) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(methylcarbamoyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid.
| Compound Name | 2-(methylcarbamoyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid |
|---|---|
| PubChem CID | 130840927 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-(methylcarbamoyl)-2-azabicyclo[2.1.1]hexane-5-carboxylic acid |
| SMILES | CNC(=O)N1CC2CC1C2C(=O)O |
| InChI | InChI=1S/C8H12N2O3/c1-9-8(13)10-3-4-2-5(10)6(4)7(11)12/h4-6H,2-3H2,1H3,(H,9,13)(H,11,12) |
| InChIKey | RUQKZJMTUCCUBR-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |