C8H12N2O3S — CID 130820222
2-cyano-N-(1,1-dioxothietan-3-yl)butanamide (PubChem CID 130820222) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-cyano-N-(1,1-dioxothietan-3-yl)butanamide.
| Compound Name | 2-cyano-N-(1,1-dioxothietan-3-yl)butanamide |
|---|---|
| PubChem CID | 130820222 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-cyano-N-(1,1-dioxothietan-3-yl)butanamide |
| SMILES | CCC(C#N)C(=O)NC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C8H12N2O3S/c1-2-6(3-9)8(11)10-7-4-14(12,13)5-7/h6-7H,2,4-5H2,1H3,(H,10,11) |
| InChIKey | WREOUYQFNYVPHJ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |