C5H7ClO3 — CID 130820482
trans-(1S,2S)-2-chloro-2-(hydroxymethyl)cyclopropane-1-carboxylic acid (PubChem CID 130820482) has the molecular formula C5H7ClO3 and a molecular weight of 150.56 g/mol. Its IUPAC name is trans-(1S,2S)-2-chloro-2-(hydroxymethyl)cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-chloro-2-(hydroxymethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 130820482 |
| Molecular Formula | C5H7ClO3 |
| Molecular Weight | 150.56 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | trans-(1S,2S)-2-chloro-2-(hydroxymethyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@]1(Cl)CO |
| InChI | InChI=1S/C5H7ClO3/c6-5(2-7)1-3(5)4(8)9/h3,7H,1-2H2,(H,8,9)/t3-,5+/m0/s1 |
| InChIKey | JOZGJTZFMVFGOF-WVZVXSGGSA-N |
| XLogP | 0.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.56 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|