C6H8Cl2O2 — CID 139535592
(1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid (PubChem CID 139535592) has the molecular formula C6H8Cl2O2 and a molecular weight of 183.03 g/mol. Its IUPAC name is (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid.
| Compound Name | (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 139535592 |
| Molecular Formula | C6H8Cl2O2 |
| Molecular Weight | 183.03 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC1(CCl)CCl |
| InChI | InChI=1S/C6H8Cl2O2/c7-2-6(3-8)1-4(6)5(9)10/h4H,1-3H2,(H,9,10)/t4-/m1/s1 |
| InChIKey | XTTUAMNKBKQEOU-SCSAIBSYSA-N |
| XLogP | 1.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.03 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|