About (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid
(1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid (PubChem CID 139535592) has the molecular formula C6H8Cl2O2
and a molecular weight of 183.03 g/mol. Its IUPAC name is (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid |
| PubChem CID | 139535592 |
| Molecular Formula | C6H8Cl2O2 |
| Molecular Weight | 183.03 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC1(CCl)CCl |
| InChI | InChI=1S/C6H8Cl2O2/c7-2-6(3-8)1-4(6)5(9)10/h4H,1-3H2,(H,9,10)/t4-/m1/s1 |
| InChIKey | XTTUAMNKBKQEOU-SCSAIBSYSA-N |
| XLogP | 1.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.03 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid?
The IUPAC name of (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid (CID 139535592) is (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid is O=C(O)[C@H]1CC1(CCl)CCl.
What is the InChIKey of (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid?
The InChIKey is XTTUAMNKBKQEOU-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H8Cl2O2/c7-2-6(3-8)1-4(6)5(9)10/h4H,1-3H2,(H,9,10)/t4-/m1/s1.
What are the key properties of (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid?
(1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid has a molecular weight of 183.03 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,2-bis(chloromethyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 139535592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).