C10H13BrClN3 — CID 130821715
5-bromo-N-[(3-chlorocyclobutyl)methyl]-4-methylpyrimidin-2-amine (PubChem CID 130821715) has the molecular formula C10H13BrClN3 and a molecular weight of 290.59 g/mol. Its IUPAC name is 5-bromo-N-[(3-chlorocyclobutyl)methyl]-4-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-N-[(3-chlorocyclobutyl)methyl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 130821715 |
| Molecular Formula | C10H13BrClN3 |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 5-bromo-N-[(3-chlorocyclobutyl)methyl]-4-methylpyrimidin-2-amine |
| SMILES | Cc1nc(NCC2CC(Cl)C2)ncc1Br |
| InChI | InChI=1S/C10H13BrClN3/c1-6-9(11)5-14-10(15-6)13-4-7-2-8(12)3-7/h5,7-8H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | INXLCUVIJJORIH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|