C11H16BrN3 — CID 130987156
5-bromo-N-(1-cyclopropylpropan-2-yl)-4-methylpyrimidin-2-amine (PubChem CID 130987156) has the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. Its IUPAC name is 5-bromo-N-(1-cyclopropylpropan-2-yl)-4-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-N-(1-cyclopropylpropan-2-yl)-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 130987156 |
| Molecular Formula | C11H16BrN3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 5-bromo-N-(1-cyclopropylpropan-2-yl)-4-methylpyrimidin-2-amine |
| SMILES | Cc1nc(NC(C)CC2CC2)ncc1Br |
| InChI | InChI=1S/C11H16BrN3/c1-7(5-9-3-4-9)14-11-13-6-10(12)8(2)15-11/h6-7,9H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | QOTFGYAYBNGPRP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |