C6H4Br2FNO2S — CID 130822552
3,4-dibromo-2-fluorobenzenesulfonamide (PubChem CID 130822552) has the molecular formula C6H4Br2FNO2S and a molecular weight of 332.98 g/mol. Its IUPAC name is 3,4-dibromo-2-fluorobenzenesulfonamide.
| Compound Name | 3,4-dibromo-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 130822552 |
| Molecular Formula | C6H4Br2FNO2S |
| Molecular Weight | 332.98 g/mol |
| Exact Mass | 330.83 |
| IUPAC Name | 3,4-dibromo-2-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Br)c(Br)c1F |
| InChI | InChI=1S/C6H4Br2FNO2S/c7-3-1-2-4(13(10,11)12)6(9)5(3)8/h1-2H,(H2,10,11,12) |
| InChIKey | DGGQAHLLRLHPJB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.98 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|