C12H2Br8O2S — CID 21329001
1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)sulfonylbenzene (PubChem CID 21329001) has the molecular formula C12H2Br8O2S and a molecular weight of 849.44 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)sulfonylbenzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 21329001 |
| Molecular Formula | C12H2Br8O2S |
| Molecular Weight | 849.44 g/mol |
| Exact Mass | 841.32 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenyl)sulfonylbenzene |
| SMILES | O=S(=O)(c1ccc(Br)c(Br)c1Br)c1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C12H2Br8O2S/c13-3-1-2-4(6(15)5(3)14)23(21,22)12-10(19)8(17)7(16)9(18)11(12)20/h1-2H |
| InChIKey | JRCKCSLSWARDTC-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.44 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|