C12H10Br2N2O2S — CID 175091393
2-(2,3-dibromophenyl)sulfonylbenzene-1,3-diamine (PubChem CID 175091393) has the molecular formula C12H10Br2N2O2S and a molecular weight of 406.10 g/mol. Its IUPAC name is 2-(2,3-dibromophenyl)sulfonylbenzene-1,3-diamine.
| Compound Name | 2-(2,3-dibromophenyl)sulfonylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 175091393 |
| Molecular Formula | C12H10Br2N2O2S |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.88 |
| IUPAC Name | 2-(2,3-dibromophenyl)sulfonylbenzene-1,3-diamine |
| SMILES | Nc1cccc(N)c1S(=O)(=O)c1cccc(Br)c1Br |
| InChI | InChI=1S/C12H10Br2N2O2S/c13-7-3-1-6-10(11(7)14)19(17,18)12-8(15)4-2-5-9(12)16/h1-6H,15-16H2 |
| InChIKey | FAOVBNHLURNTSZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|