About 2,3-dibromoaniline;hydrochloride
2,3-dibromoaniline;hydrochloride (PubChem CID 140969535) has the molecular formula C6H6Br2ClN
and a molecular weight of 287.38 g/mol. Its IUPAC name is 2,3-dibromoaniline;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dibromoaniline;hydrochloride |
| PubChem CID | 140969535 |
| Molecular Formula | C6H6Br2ClN |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 284.86 |
| IUPAC Name | 2,3-dibromoaniline;hydrochloride |
| SMILES | Cl.Nc1cccc(Br)c1Br |
| InChI | InChI=1S/C6H5Br2N.ClH/c7-4-2-1-3-5(9)6(4)8;/h1-3H,9H2;1H |
| InChIKey | CLPBMEJNLZUMAM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromoaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromoaniline;hydrochloride?
The IUPAC name of 2,3-dibromoaniline;hydrochloride (CID 140969535) is 2,3-dibromoaniline;hydrochloride.
What is the SMILES notation for 2,3-dibromoaniline;hydrochloride?
The canonical SMILES for 2,3-dibromoaniline;hydrochloride is Cl.Nc1cccc(Br)c1Br.
What is the InChIKey of 2,3-dibromoaniline;hydrochloride?
The InChIKey is CLPBMEJNLZUMAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br2N.ClH/c7-4-2-1-3-5(9)6(4)8;/h1-3H,9H2;1H.
What are the key properties of 2,3-dibromoaniline;hydrochloride?
2,3-dibromoaniline;hydrochloride has a molecular weight of 287.38 g/mol, XLogP of 3.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromoaniline;hydrochloride is sourced from PubChem (CID 140969535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).