C7H9Br2ClN2 — CID 135397409
(2,3-dibromophenyl)methylhydrazine;hydrochloride (PubChem CID 135397409) has the molecular formula C7H9Br2ClN2 and a molecular weight of 316.42 g/mol. Its IUPAC name is (2,3-dibromophenyl)methylhydrazine;hydrochloride.
| Compound Name | (2,3-dibromophenyl)methylhydrazine;hydrochloride |
|---|---|
| PubChem CID | 135397409 |
| Molecular Formula | C7H9Br2ClN2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | (2,3-dibromophenyl)methylhydrazine;hydrochloride |
| SMILES | Cl.NNCc1cccc(Br)c1Br |
| InChI | InChI=1S/C7H8Br2N2.ClH/c8-6-3-1-2-5(4-11-10)7(6)9;/h1-3,11H,4,10H2;1H |
| InChIKey | YYYSDRDUJZWJSM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|