C9H9ClO3 — CID 130826367
2-chloro-1-(2,6-dihydroxyphenyl)propan-1-one (PubChem CID 130826367) has the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. Its IUPAC name is 2-chloro-1-(2,6-dihydroxyphenyl)propan-1-one.
| Compound Name | 2-chloro-1-(2,6-dihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 130826367 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 2-chloro-1-(2,6-dihydroxyphenyl)propan-1-one |
| SMILES | CC(Cl)C(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C9H9ClO3/c1-5(10)9(13)8-6(11)3-2-4-7(8)12/h2-5,11-12H,1H3 |
| InChIKey | DUSSWEVWXKJAMI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|