C10H11ClO3 — CID 141444178
2-chloro-1-(2,4-dihydroxy-3-methylphenyl)propan-1-one (PubChem CID 141444178) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-chloro-1-(2,4-dihydroxy-3-methylphenyl)propan-1-one.
| Compound Name | 2-chloro-1-(2,4-dihydroxy-3-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 141444178 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-chloro-1-(2,4-dihydroxy-3-methylphenyl)propan-1-one |
| SMILES | Cc1c(O)ccc(C(=O)C(C)Cl)c1O |
| InChI | InChI=1S/C10H11ClO3/c1-5-8(12)4-3-7(9(5)13)10(14)6(2)11/h3-4,6,12-13H,1-2H3 |
| InChIKey | PONOZBLVTJADMH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|