C9H12NO2+ — CID 147141238
1-(2,4-dihydroxy-3-methylphenyl)ethylideneazanium (PubChem CID 147141238) has the molecular formula C9H12NO2+ and a molecular weight of 166.20 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-3-methylphenyl)ethylideneazanium.
| Compound Name | 1-(2,4-dihydroxy-3-methylphenyl)ethylideneazanium |
|---|---|
| PubChem CID | 147141238 |
| Molecular Formula | C9H12NO2+ |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-(2,4-dihydroxy-3-methylphenyl)ethylideneazanium |
| SMILES | CC(=[NH2+])c1ccc(O)c(C)c1O |
| InChI | InChI=1S/C9H11NO2/c1-5-8(11)4-3-7(6(2)10)9(5)12/h3-4,10-12H,1-2H3/p+1 |
| InChIKey | BSDVCOXNPRPENZ-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|