C7H8O4 — CID 87370519
4-hydroperoxy-2-methylbenzene-1,3-diol (PubChem CID 87370519) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is 4-hydroperoxy-2-methylbenzene-1,3-diol.
| Compound Name | 4-hydroperoxy-2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 87370519 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 4-hydroperoxy-2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)ccc(OO)c1O |
| InChI | InChI=1S/C7H8O4/c1-4-5(8)2-3-6(11-10)7(4)9/h2-3,8-10H,1H3 |
| InChIKey | DARZBWOHKKQKDI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|