About 7-bromo-4,6-diethyl-1-benzothiophene
7-bromo-4,6-diethyl-1-benzothiophene (PubChem CID 130826571) has the molecular formula C12H13BrS
and a molecular weight of 269.21 g/mol. Its IUPAC name is 7-bromo-4,6-diethyl-1-benzothiophene.
Molecular Properties
| Compound Name | 7-bromo-4,6-diethyl-1-benzothiophene |
| PubChem CID | 130826571 |
| Molecular Formula | C12H13BrS |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 7-bromo-4,6-diethyl-1-benzothiophene |
| SMILES | CCc1cc(CC)c2ccsc2c1Br |
| InChI | InChI=1S/C12H13BrS/c1-3-8-7-9(4-2)11(13)12-10(8)5-6-14-12/h5-7H,3-4H2,1-2H3 |
| InChIKey | VVJIEVWYVIEQBK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-4,6-diethyl-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4,6-diethyl-1-benzothiophene?
The IUPAC name of 7-bromo-4,6-diethyl-1-benzothiophene (CID 130826571) is 7-bromo-4,6-diethyl-1-benzothiophene.
What is the SMILES notation for 7-bromo-4,6-diethyl-1-benzothiophene?
The canonical SMILES for 7-bromo-4,6-diethyl-1-benzothiophene is CCc1cc(CC)c2ccsc2c1Br.
What is the InChIKey of 7-bromo-4,6-diethyl-1-benzothiophene?
The InChIKey is VVJIEVWYVIEQBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrS/c1-3-8-7-9(4-2)11(13)12-10(8)5-6-14-12/h5-7H,3-4H2,1-2H3.
What are the key properties of 7-bromo-4,6-diethyl-1-benzothiophene?
7-bromo-4,6-diethyl-1-benzothiophene has a molecular weight of 269.21 g/mol, XLogP of 4.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4,6-diethyl-1-benzothiophene is sourced from PubChem (CID 130826571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).