C12H13BrS — CID 130826571
7-bromo-4,6-diethyl-1-benzothiophene (PubChem CID 130826571) has the molecular formula C12H13BrS and a molecular weight of 269.21 g/mol. Its IUPAC name is 7-bromo-4,6-diethyl-1-benzothiophene.
| Compound Name | 7-bromo-4,6-diethyl-1-benzothiophene |
|---|---|
| PubChem CID | 130826571 |
| Molecular Formula | C12H13BrS |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 7-bromo-4,6-diethyl-1-benzothiophene |
| SMILES | CCc1cc(CC)c2ccsc2c1Br |
| InChI | InChI=1S/C12H13BrS/c1-3-8-7-9(4-2)11(13)12-10(8)5-6-14-12/h5-7H,3-4H2,1-2H3 |
| InChIKey | VVJIEVWYVIEQBK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |