C9H16BrNO3S — CID 130831035
1-(3-bromo-2,2-dimethylpyrrolidin-1-yl)-2-methylsulfonylethanone (PubChem CID 130831035) has the molecular formula C9H16BrNO3S and a molecular weight of 298.20 g/mol. Its IUPAC name is 1-(3-bromo-2,2-dimethylpyrrolidin-1-yl)-2-methylsulfonylethanone.
| Compound Name | 1-(3-bromo-2,2-dimethylpyrrolidin-1-yl)-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 130831035 |
| Molecular Formula | C9H16BrNO3S |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 1-(3-bromo-2,2-dimethylpyrrolidin-1-yl)-2-methylsulfonylethanone |
| SMILES | CC1(C)C(Br)CCN1C(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C9H16BrNO3S/c1-9(2)7(10)4-5-11(9)8(12)6-15(3,13)14/h7H,4-6H2,1-3H3 |
| InChIKey | VVRLAKLXKQQMLG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|