C9H17N3O4S — CID 77041611
N'-hydroxy-1-(2-methylsulfonylacetyl)piperidine-2-carboximidamide (PubChem CID 77041611) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is N'-hydroxy-1-(2-methylsulfonylacetyl)piperidine-2-carboximidamide.
| Compound Name | N'-hydroxy-1-(2-methylsulfonylacetyl)piperidine-2-carboximidamide |
|---|---|
| PubChem CID | 77041611 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N'-hydroxy-1-(2-methylsulfonylacetyl)piperidine-2-carboximidamide |
| SMILES | CS(=O)(=O)CC(=O)N1CCCCC1C(N)=NO |
| InChI | InChI=1S/C9H17N3O4S/c1-17(15,16)6-8(13)12-5-3-2-4-7(12)9(10)11-14/h7,14H,2-6H2,1H3,(H2,10,11) |
| InChIKey | NMDMEAOJTQANDP-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|